FertiJourney Dev Tools 🏠← All tools

Chemical Equation Balancer

Balance chemical equations instantly. Enter an unbalanced reaction like H2+O2=H2O and get the smallest whole-number coefficients (e.g. 2H2+O2=2H2O) with a per-element conservation check. Supports common elements and parentheses such as Ca(NO3)2 — 100% in your browser.

Examples:
Enter a reaction using = (or →) between reactants and products and + between species, e.g. H2+O2=H2O or Fe+O2=Fe2O3. Parentheses are supported, e.g. Ca(OH)2+H3PO4=Ca3(PO4)2+H2O. The tool parses each formula into element counts, builds a linear system, and solves for the smallest integer coefficients via rational Gaussian elimination, then verifies atom conservation for every element. Do not include charges or state symbols (s)/(g)/(aq).